Products 1251222-83-9

CAS 1251222-83-9 is the registry number for Methyl 2-(4-fluoro-2-methylphenyl)-2-hydroxyacetate. Offered by: Biosynth. Available pack sizes: 100mg, 1g.

Structural formula: {0} (CAS {1})

Methyl 2-(4-fluoro-2-methylphenyl)-2-hydroxyacetate (CAS 1251222-83-9) is a chemical compound with the molecular formula C10H11FO3 and a molecular weight of 198.19 g/mol. IUPAC name: methyl 2-(4-fluoro-2-methylphenyl)-2-hydroxyacetate. InChIKey: VRSFSIIONJHLPE-UHFFFAOYSA-N.

Identity
Molecular formulaC10H11FO3
Molecular weight198.19 g/mol
IUPAC namemethyl 2-(4-fluoro-2-methylphenyl)-2-hydroxyacetate
InChIKeyVRSFSIIONJHLPE-UHFFFAOYSA-N
SMILESCC1=C(C=CC(=C1)F)C(C(=O)OC)O

Computed by PubChem (NCBI)