CAS 125126-73-0 is the registry number for 1-(2,4-Difluorophenyl)-2,5-dimethyl-1H-pyrrole-3-carbaldehyde, 95%. Offered by: AmBeed. Available pack sizes: 5g.
1-(2,4-difluorophenyl)-2,5-dimethylpyrrole-3-carbaldehyde (CAS 125126-73-0) is a chemical compound with the molecular formula C13H11F2NO and a molecular weight of 235.23 g/mol. IUPAC name: 1-(2,4-difluorophenyl)-2,5-dimethylpyrrole-3-carbaldehyde. InChIKey: MVDLNJHLFFSBDE-UHFFFAOYSA-N.
| Molecular formula | C13H11F2NO |
|---|---|
| Molecular weight | 235.23 g/mol |
| IUPAC name | 1-(2,4-difluorophenyl)-2,5-dimethylpyrrole-3-carbaldehyde |
| InChIKey | MVDLNJHLFFSBDE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(N1C2=C(C=C(C=C2)F)F)C)C=O |
Computed by PubChem (NCBI)