CAS 867288-00-4 appears in our catalog under these names: 3,5–Difluoro–3'–methoxy–(1,1'–biphenyl)–4–amine, 3,5-Difluoro-3'-methoxy-[1,1'-biphenyl]-4-amine, 95%, 3,5-Difluoro-3'-methoxy-[1,1'-biphenyl]-4-amine 97%, 3,5-Difluoro-3'-methoxy-[1,1'-biphenyl]-4-amine, 97%, 97%, 3,5-Difluoro-3'-methoxy-[1,1'-biphenyl]-4-amine, 98%. Offered by: GLPBio, Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g.
2,6-difluoro-4-(3-methoxyphenyl)aniline (CAS 867288-00-4) is a chemical compound with the molecular formula C13H11F2NO and a molecular weight of 235.23 g/mol. IUPAC name: 2,6-difluoro-4-(3-methoxyphenyl)aniline. InChIKey: BFAMMODYWZEGDM-UHFFFAOYSA-N.
| Molecular formula | C13H11F2NO |
|---|---|
| Molecular weight | 235.23 g/mol |
| IUPAC name | 2,6-difluoro-4-(3-methoxyphenyl)aniline |
| InChIKey | BFAMMODYWZEGDM-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)C2=CC(=C(C(=C2)F)N)F |
Computed by PubChem (NCBI)