CAS 847861-59-0 appears in our catalog under these names: 4-(Benzyloxy)-3,5-difluoroaniline, 90%, 90%, 4-(Benzyloxy)-3,5-difluoroaniline, 90%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg.
3,5-difluoro-4-phenylmethoxyaniline (CAS 847861-59-0) is a chemical compound with the molecular formula C13H11F2NO and a molecular weight of 235.23 g/mol. IUPAC name: 3,5-difluoro-4-phenylmethoxyaniline. InChIKey: FKRSQFDHYHBHFX-UHFFFAOYSA-N.
| Molecular formula | C13H11F2NO |
|---|---|
| Molecular weight | 235.23 g/mol |
| IUPAC name | 3,5-difluoro-4-phenylmethoxyaniline |
| InChIKey | FKRSQFDHYHBHFX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=C(C=C2F)N)F |
Computed by PubChem (NCBI)