Products 1251829-99-8
CAS 1251829-99-8 is the registry number for (S,S)-Ketone monoester. Offered by: MedChemExpress. Available pack sizes: Get quote.
[(3S)-3-hydroxybutyl] (3S)-3-hydroxybutanoate (CAS 1251829-99-8) is a chemical compound with the molecular formula C8H16O4 and a molecular weight of 176.21 g/mol. IUPAC name: [(3S)-3-hydroxybutyl] (3S)-3-hydroxybutanoate. InChIKey: AOWPVIWVMWUSBD-BQBZGAKWSA-N.
| Molecular formula | C8H16O4 |
|---|---|
| Molecular weight | 176.21 g/mol |
| IUPAC name | [(3S)-3-hydroxybutyl] (3S)-3-hydroxybutanoate |
| InChIKey | AOWPVIWVMWUSBD-BQBZGAKWSA-N |
| SMILES | C[C@@H](CCOC(=O)C[C@H](C)O)O |
Computed by PubChem (NCBI)