Products 1251841-50-5
CAS 1251841-50-5 is the registry number for AZD6564. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-[(2R,4S)-2-(2,2-dimethylpropyl)piperidin-4-yl]-1,2-oxazol-3-one (CAS 1251841-50-5) is a chemical compound with the molecular formula C13H22N2O2 and a molecular weight of 238.33 g/mol. IUPAC name: 5-[(2R,4S)-2-(2,2-dimethylpropyl)piperidin-4-yl]-1,2-oxazol-3-one. InChIKey: ORLPPUHANSFJCS-VHSXEESVSA-N.
| Molecular formula | C13H22N2O2 |
|---|---|
| Molecular weight | 238.33 g/mol |
| IUPAC name | 5-[(2R,4S)-2-(2,2-dimethylpropyl)piperidin-4-yl]-1,2-oxazol-3-one |
| InChIKey | ORLPPUHANSFJCS-VHSXEESVSA-N |
| SMILES | CC(C)(C)C[C@H]1C[C@H](CCN1)C2=CC(=O)NO2 |
Computed by PubChem (NCBI)