Products 1251923-32-6
CAS 1251923-32-6 is the registry number for 2-(1H-Imidazol-5-yl)-1,3-thiazole-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-(1H-imidazol-5-yl)-1,3-thiazole-4-carboxylic acid (CAS 1251923-32-6) is a chemical compound with the molecular formula C7H5N3O2S and a molecular weight of 195.20 g/mol. IUPAC name: 2-(1H-imidazol-5-yl)-1,3-thiazole-4-carboxylic acid. InChIKey: QHWMNASLGCGQNK-UHFFFAOYSA-N.
| Molecular formula | C7H5N3O2S |
|---|---|
| Molecular weight | 195.20 g/mol |
| IUPAC name | 2-(1H-imidazol-5-yl)-1,3-thiazole-4-carboxylic acid |
| InChIKey | QHWMNASLGCGQNK-UHFFFAOYSA-N |
| SMILES | C1=C(NC=N1)C2=NC(=CS2)C(=O)O |
Computed by PubChem (NCBI)