Products 1251924-13-6
CAS 1251924-13-6 appears in our catalog under these names: 5-(2-Chloroacetyl)furan-3-carboxylic acid, 95%, 5-(2-Chloroacetyl)furan-3-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
5-(2-chloroacetyl)furan-3-carboxylic acid (CAS 1251924-13-6) is a chemical compound with the molecular formula C7H5ClO4 and a molecular weight of 188.56 g/mol. IUPAC name: 5-(2-chloroacetyl)furan-3-carboxylic acid. InChIKey: PPAQBKZLWGHNAC-UHFFFAOYSA-N.
| Molecular formula | C7H5ClO4 |
|---|---|
| Molecular weight | 188.56 g/mol |
| IUPAC name | 5-(2-chloroacetyl)furan-3-carboxylic acid |
| InChIKey | PPAQBKZLWGHNAC-UHFFFAOYSA-N |
| SMILES | C1=C(OC=C1C(=O)O)C(=O)CCl |
Computed by PubChem (NCBI)