CAS 87932-49-8 appears in our catalog under these names: 3–Chloro–4,5–dihydroxybenzoic acid, 3-Chloro-4,5-dihydroxybenzoic acid 95%, 3-Chloro-4,5-dihydroxybenzoic acid, 95%, 95%, 3-Chloro-4,5-dihydroxybenzoic acid, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g.
3-chloro-4,5-dihydroxybenzoic acid (CAS 87932-49-8) is a chemical compound with the molecular formula C7H5ClO4 and a molecular weight of 188.56 g/mol. IUPAC name: 3-chloro-4,5-dihydroxybenzoic acid. InChIKey: GGUNECQLDCNDDY-UHFFFAOYSA-N.
| Molecular formula | C7H5ClO4 |
|---|---|
| Molecular weight | 188.56 g/mol |
| IUPAC name | 3-chloro-4,5-dihydroxybenzoic acid |
| InChIKey | GGUNECQLDCNDDY-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1O)O)Cl)C(=O)O |
Computed by PubChem (NCBI)