CAS 67828-44-8 appears in our catalog under these names: 5-Chloro-2,4-dihydroxybenzoic acid, 95%, 5-Chloro-2,4-dihydroxybenzoic acid, 95-<97%, 5–Chloro–2,4–dihydroxybenzoic acid, 5-Chloro-2,4-dihydroxybenzoic acid, 5-Chloro-2,4-Dihydroxybenzoic Acid, 95%, 95%. Offered by: Combi-blocks, Chemat Brand, Hoffman Fine Chemicals, GLPBio, Chemat. Available pack sizes: 1g, 5g, 250mg, on request, 2,5g, 10g, 25g, 50g.
5-chloro-2,4-dihydroxybenzoic acid (CAS 67828-44-8) is a chemical compound with the molecular formula C7H5ClO4 and a molecular weight of 188.56 g/mol. IUPAC name: 5-chloro-2,4-dihydroxybenzoic acid. InChIKey: SAZOOWOGQNYJLS-UHFFFAOYSA-N.
| Molecular formula | C7H5ClO4 |
|---|---|
| Molecular weight | 188.56 g/mol |
| IUPAC name | 5-chloro-2,4-dihydroxybenzoic acid |
| InChIKey | SAZOOWOGQNYJLS-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Cl)O)O)C(=O)O |
Computed by PubChem (NCBI)