CAS 1251924-39-6 appears in our catalog under these names: tert-butyl N-(1-carbamothioylcyclobutyl)carbamate, 98%, tert-Butyl N-(1-carbamothioylcyclobutyl)carbamate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 10g, 100mg, 1g.
Tert-butyl N-(1-carbamothioylcyclobutyl)carbamate (CAS 1251924-39-6) is a chemical compound with the molecular formula C10H18N2O2S and a molecular weight of 230.33 g/mol. IUPAC name: tert-butyl N-(1-carbamothioylcyclobutyl)carbamate. InChIKey: LDBBHDGQQKVLCS-UHFFFAOYSA-N.
| Molecular formula | C10H18N2O2S |
|---|---|
| Molecular weight | 230.33 g/mol |
| IUPAC name | tert-butyl N-(1-carbamothioylcyclobutyl)carbamate |
| InChIKey | LDBBHDGQQKVLCS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1(CCC1)C(=S)N |
Computed by PubChem (NCBI)