Products 2095671-25-1
CAS 2095671-25-1 is the registry number for tert-Butyl 3-carbamothioyl-3-methylazetidine-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 3-carbamothioyl-3-methylazetidine-1-carboxylate (CAS 2095671-25-1) is a chemical compound with the molecular formula C10H18N2O2S and a molecular weight of 230.33 g/mol. IUPAC name: tert-butyl 3-carbamothioyl-3-methylazetidine-1-carboxylate. InChIKey: VDNPFTCRGZVRSY-UHFFFAOYSA-N.
| Molecular formula | C10H18N2O2S |
|---|---|
| Molecular weight | 230.33 g/mol |
| IUPAC name | tert-butyl 3-carbamothioyl-3-methylazetidine-1-carboxylate |
| InChIKey | VDNPFTCRGZVRSY-UHFFFAOYSA-N |
| SMILES | CC1(CN(C1)C(=O)OC(C)(C)C)C(=S)N |
Computed by PubChem (NCBI)