CAS 53906-36-8 appears in our catalog under these names: D-Biotinol, 96%, D–Biotinol, D-Biotinol 96%, D-BIOTINOL, 96%, 96%, D-Biotinol, 98.0%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1g, 250mg, 500mg, 100mg, 5g, 25 mg, 5 mg, 50 mg.
(3aS,4S,6aR)-4-(5-hydroxypentyl)-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one (CAS 53906-36-8) is a chemical compound with the molecular formula C10H18N2O2S and a molecular weight of 230.33 g/mol. IUPAC name: (3aS,4S,6aR)-4-(5-hydroxypentyl)-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one. InChIKey: RGIKRHKHRAAZIO-CIUDSAMLSA-N.
| Molecular formula | C10H18N2O2S |
|---|---|
| Molecular weight | 230.33 g/mol |
| IUPAC name | (3aS,4S,6aR)-4-(5-hydroxypentyl)-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one |
| InChIKey | RGIKRHKHRAAZIO-CIUDSAMLSA-N |
| SMILES | C1[C@H]2[C@@H]([C@@H](S1)CCCCCO)NC(=O)N2 |
Computed by PubChem (NCBI)