CAS 1251924-60-3 is the registry number for 2–Chloro–N–(5–(tetrahydrofuran–2–yl)–1,3,4–oxadiazol–2–yl)acetamide. Offered by: GLPBio. Available pack sizes: 10g, 1g, 5g.
2-chloro-N-[5-(oxolan-2-yl)-1,3,4-oxadiazol-2-yl]acetamide (CAS 1251924-60-3) is a chemical compound with the molecular formula C8H10ClN3O3 and a molecular weight of 231.63 g/mol. IUPAC name: 2-chloro-N-[5-(oxolan-2-yl)-1,3,4-oxadiazol-2-yl]acetamide. InChIKey: DCVMRUJYKDAOHJ-UHFFFAOYSA-N.
| Molecular formula | C8H10ClN3O3 |
|---|---|
| Molecular weight | 231.63 g/mol |
| IUPAC name | 2-chloro-N-[5-(oxolan-2-yl)-1,3,4-oxadiazol-2-yl]acetamide |
| InChIKey | DCVMRUJYKDAOHJ-UHFFFAOYSA-N |
| SMILES | C1CC(OC1)C2=NN=C(O2)NC(=O)CCl |
Computed by PubChem (NCBI)