CAS 67130-66-9 is the registry number for 6-Amino-5-(2-chloro-acetyl)-1,3-dimethyl-1h-pyrimidine-2,4-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 250mg, 5g.
6-amino-5-(2-chloroacetyl)-1,3-dimethylpyrimidine-2,4-dione (CAS 67130-66-9) is a chemical compound with the molecular formula C8H10ClN3O3 and a molecular weight of 231.63 g/mol. IUPAC name: 6-amino-5-(2-chloroacetyl)-1,3-dimethylpyrimidine-2,4-dione. InChIKey: QZIHPCABEPSLMA-UHFFFAOYSA-N.
| Molecular formula | C8H10ClN3O3 |
|---|---|
| Molecular weight | 231.63 g/mol |
| IUPAC name | 6-amino-5-(2-chloroacetyl)-1,3-dimethylpyrimidine-2,4-dione |
| InChIKey | QZIHPCABEPSLMA-UHFFFAOYSA-N |
| SMILES | CN1C(=C(C(=O)N(C1=O)C)C(=O)CCl)N |
Computed by PubChem (NCBI)