CAS 360068-47-9 is the registry number for Sildenafil Impurity 59. Offered by: Chemat Brand. Available pack sizes: on request.
1-methyl-4-nitro-3-propylpyrazole-5-carbonyl chloride (CAS 360068-47-9) is a chemical compound with the molecular formula C8H10ClN3O3 and a molecular weight of 231.63 g/mol. IUPAC name: 1-methyl-4-nitro-3-propylpyrazole-5-carbonyl chloride. InChIKey: VHSXOOIDWUWCII-UHFFFAOYSA-N.
| Molecular formula | C8H10ClN3O3 |
|---|---|
| Molecular weight | 231.63 g/mol |
| IUPAC name | 1-methyl-4-nitro-3-propylpyrazole-5-carbonyl chloride |
| InChIKey | VHSXOOIDWUWCII-UHFFFAOYSA-N |
| SMILES | CCCC1=NN(C(=C1[N+](=O)[O-])C(=O)Cl)C |
Computed by PubChem (NCBI)