Products 360068-47-9

CAS 360068-47-9 is the registry number for Sildenafil Impurity 59. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

1-methyl-4-nitro-3-propylpyrazole-5-carbonyl chloride (CAS 360068-47-9) is a chemical compound with the molecular formula C8H10ClN3O3 and a molecular weight of 231.63 g/mol. IUPAC name: 1-methyl-4-nitro-3-propylpyrazole-5-carbonyl chloride. InChIKey: VHSXOOIDWUWCII-UHFFFAOYSA-N.

Identity
Molecular formulaC8H10ClN3O3
Molecular weight231.63 g/mol
IUPAC name1-methyl-4-nitro-3-propylpyrazole-5-carbonyl chloride
InChIKeyVHSXOOIDWUWCII-UHFFFAOYSA-N
SMILESCCCC1=NN(C(=C1[N+](=O)[O-])C(=O)Cl)C

Computed by PubChem (NCBI)