CAS 1251925-16-2 appears in our catalog under these names: 5-(2-Bromo-4-fluorophenyl)-5-methylimidazolidine-2,4-dione, 95%, 5-(2-Bromo-4-fluorophenyl)-5-methylimidazolidine-2,4-dione. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
5-(2-bromo-4-fluorophenyl)-5-methylimidazolidine-2,4-dione (CAS 1251925-16-2) is a chemical compound with the molecular formula C10H8BrFN2O2 and a molecular weight of 287.08 g/mol. IUPAC name: 5-(2-bromo-4-fluorophenyl)-5-methylimidazolidine-2,4-dione. InChIKey: KJYHFTNCVUKMRE-UHFFFAOYSA-N.
| Molecular formula | C10H8BrFN2O2 |
|---|---|
| Molecular weight | 287.08 g/mol |
| IUPAC name | 5-(2-bromo-4-fluorophenyl)-5-methylimidazolidine-2,4-dione |
| InChIKey | KJYHFTNCVUKMRE-UHFFFAOYSA-N |
| SMILES | CC1(C(=O)NC(=O)N1)C2=C(C=C(C=C2)F)Br |
Computed by PubChem (NCBI)