CAS 1515197-90-6 appears in our catalog under these names: 1-(4-Bromo-3-fluorophenyl)dihydropyrimidine-2,4(1H,3H)-dione, 98%, 1-(4-Bromo-3-fluorophenyl)dihydropyrimidine-2,4(1H,3H)-dione, 98%, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 250mg, 1g.
1-(4-bromo-3-fluorophenyl)-1,3-diazinane-2,4-dione (CAS 1515197-90-6) is a chemical compound with the molecular formula C10H8BrFN2O2 and a molecular weight of 287.08 g/mol. IUPAC name: 1-(4-bromo-3-fluorophenyl)-1,3-diazinane-2,4-dione. InChIKey: CMDVHROFZVQEBL-UHFFFAOYSA-N.
| Molecular formula | C10H8BrFN2O2 |
|---|---|
| Molecular weight | 287.08 g/mol |
| IUPAC name | 1-(4-bromo-3-fluorophenyl)-1,3-diazinane-2,4-dione |
| InChIKey | CMDVHROFZVQEBL-UHFFFAOYSA-N |
| SMILES | C1CN(C(=O)NC1=O)C2=CC(=C(C=C2)Br)F |
Computed by PubChem (NCBI)