Products 1400644-97-4

CAS 1400644-97-4 is the registry number for 6-Bromo-1-ethyl-7-fluoro-4H-quinoxaline-2,3-dione, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g, 25g.

Structural formula: {0} (CAS {1})

7-bromo-4-ethyl-6-fluoro-1H-quinoxaline-2,3-dione (CAS 1400644-97-4) is a chemical compound with the molecular formula C10H8BrFN2O2 and a molecular weight of 287.08 g/mol. IUPAC name: 7-bromo-4-ethyl-6-fluoro-1H-quinoxaline-2,3-dione. InChIKey: MKDNXUSXOKMGIH-UHFFFAOYSA-N.

Identity
Molecular formulaC10H8BrFN2O2
Molecular weight287.08 g/mol
IUPAC name7-bromo-4-ethyl-6-fluoro-1H-quinoxaline-2,3-dione
InChIKeyMKDNXUSXOKMGIH-UHFFFAOYSA-N
SMILESCCN1C2=CC(=C(C=C2NC(=O)C1=O)Br)F

Computed by PubChem (NCBI)