Products 125225-26-5
CAS 125225-26-5 is the registry number for (S)-1-Hydroxy-2,3-dihydro-1H-indene-4-carbonitrile, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(1S)-1-hydroxy-2,3-dihydro-1H-indene-4-carbonitrile (CAS 125225-26-5) is a chemical compound with the molecular formula C10H9NO and a molecular weight of 159.18 g/mol. IUPAC name: (1S)-1-hydroxy-2,3-dihydro-1H-indene-4-carbonitrile. InChIKey: MEFZMTYUOQFQHF-JTQLQIEISA-N.
| Molecular formula | C10H9NO |
|---|---|
| Molecular weight | 159.18 g/mol |
| IUPAC name | (1S)-1-hydroxy-2,3-dihydro-1H-indene-4-carbonitrile |
| InChIKey | MEFZMTYUOQFQHF-JTQLQIEISA-N |
| SMILES | C1CC2=C(C=CC=C2[C@H]1O)C#N |
Computed by PubChem (NCBI)