CAS 1252362-53-0 appears in our catalog under these names: 6-chloro-N4-cyclopropyl-N4-(thiophen-2-ylmethyl)pyrimidine-2,4-diamine, LRE1/ 100%, LRE1, LRE1 97%, 6-Chloro-N4-cyclopropyl-N4-(thiophen-2-ylmethyl)pyrimidine-2,4-diamine, 98%, 98%. Offered by: TRC, TargetMol, Biosynth, Ambeed, Chemat. Available pack sizes: 500mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 1g.
6-chloro-4-N-cyclopropyl-4-N-(thiophen-2-ylmethyl)pyrimidine-2,4-diamine (CAS 1252362-53-0) is a chemical compound with the molecular formula C12H13ClN4S and a molecular weight of 280.78 g/mol. IUPAC name: 6-chloro-4-N-cyclopropyl-4-N-(thiophen-2-ylmethyl)pyrimidine-2,4-diamine. InChIKey: PDWZXKSZLRVSEH-UHFFFAOYSA-N.
| Molecular formula | C12H13ClN4S |
|---|---|
| Molecular weight | 280.78 g/mol |
| IUPAC name | 6-chloro-4-N-cyclopropyl-4-N-(thiophen-2-ylmethyl)pyrimidine-2,4-diamine |
| InChIKey | PDWZXKSZLRVSEH-UHFFFAOYSA-N |
| SMILES | C1CC1N(CC2=CC=CS2)C3=CC(=NC(=N3)N)Cl |
Computed by PubChem (NCBI)