CAS 1424605-11-7 is the registry number for 6-Chloro-N4-cyclopropyl-N4-(thiophen-3-ylmethyl)pyrimidine-2,4-diamine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-chloro-4-N-cyclopropyl-4-N-(thiophen-3-ylmethyl)pyrimidine-2,4-diamine (CAS 1424605-11-7) is a chemical compound with the molecular formula C12H13ClN4S and a molecular weight of 280.78 g/mol. IUPAC name: 6-chloro-4-N-cyclopropyl-4-N-(thiophen-3-ylmethyl)pyrimidine-2,4-diamine. InChIKey: MJIBDCTWANJCKV-UHFFFAOYSA-N.
| Molecular formula | C12H13ClN4S |
|---|---|
| Molecular weight | 280.78 g/mol |
| IUPAC name | 6-chloro-4-N-cyclopropyl-4-N-(thiophen-3-ylmethyl)pyrimidine-2,4-diamine |
| InChIKey | MJIBDCTWANJCKV-UHFFFAOYSA-N |
| SMILES | C1CC1N(CC2=CSC=C2)C3=CC(=NC(=N3)N)Cl |
Computed by PubChem (NCBI)