Products 879319-52-5
CAS 879319-52-5 appears in our catalog under these names: 4-(3-Chlorophenyl)-5-pyrrolidin-1-yl-4h-1,2,4-triazole-3-thiol, 95%, 4-(3-Chlorophenyl)-5-(pyrrolidin-1-yl)-4H-1,2,4-triazole-3-thiol. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 0,5g.
4-(3-chlorophenyl)-3-pyrrolidin-1-yl-1H-1,2,4-triazole-5-thione (CAS 879319-52-5) is a chemical compound with the molecular formula C12H13ClN4S and a molecular weight of 280.78 g/mol. IUPAC name: 4-(3-chlorophenyl)-3-pyrrolidin-1-yl-1H-1,2,4-triazole-5-thione. InChIKey: HUUSRIDVGXDBGE-UHFFFAOYSA-N.
| Molecular formula | C12H13ClN4S |
|---|---|
| Molecular weight | 280.78 g/mol |
| IUPAC name | 4-(3-chlorophenyl)-3-pyrrolidin-1-yl-1H-1,2,4-triazole-5-thione |
| InChIKey | HUUSRIDVGXDBGE-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)C2=NNC(=S)N2C3=CC(=CC=C3)Cl |
Computed by PubChem (NCBI)