CAS 1252362-62-1 is the registry number for N-(1-Ethyl-1H-pyrazol-4-yl)pivalamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(1-ethylpyrazol-4-yl)-2,2-dimethylpropanamide (CAS 1252362-62-1) is a chemical compound with the molecular formula C10H17N3O and a molecular weight of 195.26 g/mol. IUPAC name: N-(1-ethylpyrazol-4-yl)-2,2-dimethylpropanamide. InChIKey: RGRIETVJHIAMOD-UHFFFAOYSA-N.
| Molecular formula | C10H17N3O |
|---|---|
| Molecular weight | 195.26 g/mol |
| IUPAC name | N-(1-ethylpyrazol-4-yl)-2,2-dimethylpropanamide |
| InChIKey | RGRIETVJHIAMOD-UHFFFAOYSA-N |
| SMILES | CCN1C=C(C=N1)NC(=O)C(C)(C)C |
Computed by PubChem (NCBI)