CAS 1820576-33-7 is the registry number for ((2S,3R)-2-(1-Ethyl-1H-pyrazol-4-yl)tetrahydrofuran-3-yl)methanamine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[(2S,3R)-2-(1-ethylpyrazol-4-yl)oxolan-3-yl]methanamine (CAS 1820576-33-7) is a chemical compound with the molecular formula C10H17N3O and a molecular weight of 195.26 g/mol. IUPAC name: [(2S,3R)-2-(1-ethylpyrazol-4-yl)oxolan-3-yl]methanamine. InChIKey: CWHDRUFJAVOTOM-SCZZXKLOSA-N.
| Molecular formula | C10H17N3O |
|---|---|
| Molecular weight | 195.26 g/mol |
| IUPAC name | [(2S,3R)-2-(1-ethylpyrazol-4-yl)oxolan-3-yl]methanamine |
| InChIKey | CWHDRUFJAVOTOM-SCZZXKLOSA-N |
| SMILES | CCN1C=C(C=N1)[C@@H]2[C@H](CCO2)CN |
Computed by PubChem (NCBI)