Products 915924-51-5

CAS 915924-51-5 is the registry number for 2-(3-Isopropyl-1,2,4-oxadiazol-5-yl)piperidine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 1g.

Structural formula: {0} (CAS {1})

5-piperidin-2-yl-3-propan-2-yl-1,2,4-oxadiazole (CAS 915924-51-5) is a chemical compound with the molecular formula C10H17N3O and a molecular weight of 195.26 g/mol. IUPAC name: 5-piperidin-2-yl-3-propan-2-yl-1,2,4-oxadiazole. InChIKey: QSFLIDKBFXPPIK-UHFFFAOYSA-N.

Identity
Molecular formulaC10H17N3O
Molecular weight195.26 g/mol
IUPAC name5-piperidin-2-yl-3-propan-2-yl-1,2,4-oxadiazole
InChIKeyQSFLIDKBFXPPIK-UHFFFAOYSA-N
SMILESCC(C)C1=NOC(=N1)C2CCCCN2

Computed by PubChem (NCBI)