CAS 1252436-78-4 is the registry number for Methyl 4-((3-cyano-1H-1,2,4-triazol-1-yl)methyl)benzoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 4-[(3-cyano-1,2,4-triazol-1-yl)methyl]benzoate (CAS 1252436-78-4) is a chemical compound with the molecular formula C12H10N4O2 and a molecular weight of 242.23 g/mol. IUPAC name: methyl 4-[(3-cyano-1,2,4-triazol-1-yl)methyl]benzoate. InChIKey: FFIGTWGATMUXQN-UHFFFAOYSA-N.
| Molecular formula | C12H10N4O2 |
|---|---|
| Molecular weight | 242.23 g/mol |
| IUPAC name | methyl 4-[(3-cyano-1,2,4-triazol-1-yl)methyl]benzoate |
| InChIKey | FFIGTWGATMUXQN-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)CN2C=NC(=N2)C#N |
Computed by PubChem (NCBI)