CAS 13113-75-2 appears in our catalog under these names: 3-(4-nitrophenyl)-1-phenyltriaz-1-ene, 4–Nitrodiazoaminobenzene, 4-Nitrodiazoaminobenzene. Offered by: Chemat Brand, GLPBio, Chemat. Available pack sizes: on request, 25g, 250mg, 1g, 5g.
N-[(4-nitrophenyl)diazenyl]aniline (CAS 13113-75-2) is a chemical compound with the molecular formula C12H10N4O2 and a molecular weight of 242.23 g/mol. IUPAC name: N-[(4-nitrophenyl)diazenyl]aniline. InChIKey: VPLPKIVQGJVXDR-UHFFFAOYSA-N.
| Molecular formula | C12H10N4O2 |
|---|---|
| Molecular weight | 242.23 g/mol |
| IUPAC name | N-[(4-nitrophenyl)diazenyl]aniline |
| InChIKey | VPLPKIVQGJVXDR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NN=NC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)