CAS 132461-40-6 appears in our catalog under these names: 3,4-Dimethyl-2-nitro-3H-imidazo[4,5-f]quinoline, 98%, 3,4-Dimethyl-2-nitro-3H-imidazo(4,5-f)quinoline. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 50mg, 5mg.
3,4-dimethyl-2-nitroimidazo[4,5-f]quinoline (CAS 132461-40-6) is a chemical compound with the molecular formula C12H10N4O2 and a molecular weight of 242.23 g/mol. IUPAC name: 3,4-dimethyl-2-nitroimidazo[4,5-f]quinoline. InChIKey: XJRHRJQXADPVJG-UHFFFAOYSA-N.
| Molecular formula | C12H10N4O2 |
|---|---|
| Molecular weight | 242.23 g/mol |
| IUPAC name | 3,4-dimethyl-2-nitroimidazo[4,5-f]quinoline |
| InChIKey | XJRHRJQXADPVJG-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=CC=N2)C3=C1N(C(=N3)[N+](=O)[O-])C |
Computed by PubChem (NCBI)