CAS 1252566-73-6 is the registry number for 3-(2-Methylthiazol-4-yl)-1-(pyrrolidin-1-yl)prop-2-en-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(E)-3-(2-methyl-1,3-thiazol-4-yl)-1-pyrrolidin-1-ylprop-2-en-1-one (CAS 1252566-73-6) is a chemical compound with the molecular formula C11H14N2OS and a molecular weight of 222.31 g/mol. IUPAC name: (E)-3-(2-methyl-1,3-thiazol-4-yl)-1-pyrrolidin-1-ylprop-2-en-1-one. InChIKey: CJIPSSTWELJHBN-SNAWJCMRSA-N.
| Molecular formula | C11H14N2OS |
|---|---|
| Molecular weight | 222.31 g/mol |
| IUPAC name | (E)-3-(2-methyl-1,3-thiazol-4-yl)-1-pyrrolidin-1-ylprop-2-en-1-one |
| InChIKey | CJIPSSTWELJHBN-SNAWJCMRSA-N |
| SMILES | CC1=NC(=CS1)/C=C/C(=O)N2CCCC2 |
Computed by PubChem (NCBI)