CAS 447412-24-0 appears in our catalog under these names: 2-Amino-4,4,6,6-tetramethyl-4,6-dihydrothieno[2,3-c]furan-3-carbonitrile, 95%, 2-Amino-4,4,6,6-tetramethyl-4,6-dihydrothieno(2,3-c)furan-3-carbonitrile, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
2-amino-4,4,6,6-tetramethylthieno[2,3-c]furan-3-carbonitrile (CAS 447412-24-0) is a chemical compound with the molecular formula C11H14N2OS and a molecular weight of 222.31 g/mol. IUPAC name: 2-amino-4,4,6,6-tetramethylthieno[2,3-c]furan-3-carbonitrile. InChIKey: MOKRFKOKZIASDJ-UHFFFAOYSA-N.
| Molecular formula | C11H14N2OS |
|---|---|
| Molecular weight | 222.31 g/mol |
| IUPAC name | 2-amino-4,4,6,6-tetramethylthieno[2,3-c]furan-3-carbonitrile |
| InChIKey | MOKRFKOKZIASDJ-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(C(O1)(C)C)SC(=C2C#N)N)C |
Computed by PubChem (NCBI)