CAS 309280-14-6 is the registry number for 1-Cyclopropyl-2-[(4,6-dimethylpyrimidin-2-yl)thio]ethanone, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
1-cyclopropyl-2-(4,6-dimethylpyrimidin-2-yl)sulfanylethanone (CAS 309280-14-6) is a chemical compound with the molecular formula C11H14N2OS and a molecular weight of 222.31 g/mol. IUPAC name: 1-cyclopropyl-2-(4,6-dimethylpyrimidin-2-yl)sulfanylethanone. InChIKey: RBETWEFFJPQBFE-UHFFFAOYSA-N.
| Molecular formula | C11H14N2OS |
|---|---|
| Molecular weight | 222.31 g/mol |
| IUPAC name | 1-cyclopropyl-2-(4,6-dimethylpyrimidin-2-yl)sulfanylethanone |
| InChIKey | RBETWEFFJPQBFE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=N1)SCC(=O)C2CC2)C |
Computed by PubChem (NCBI)