CAS 1252576-13-8 appears in our catalog under these names: (S)-Ph-quinox, 95%, (S)–4–Phenyl–2–(quinolin–2–yl)–4,5–dihydrooxazole, (S)-Ph-Quinox, 97% 99%ee, 97% 99%ee, (S)-4-Phenyl-2-(quinolin-2-yl)-4,5-dihydrooxazole, 97%, (S)-4-Phenyl-2-(quinolin-2-yl)-4,5-dihydrooxazole, 97% 99%ee. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 100mg, 1g, 50mg, 5g, 10g.
(4S)-4-phenyl-2-quinolin-2-yl-4,5-dihydro-1,3-oxazole (CAS 1252576-13-8) is a chemical compound with the molecular formula C18H14N2O and a molecular weight of 274.3 g/mol. IUPAC name: (4S)-4-phenyl-2-quinolin-2-yl-4,5-dihydro-1,3-oxazole. InChIKey: OIFADUQNTPUCKK-QGZVFWFLSA-N.
| Molecular formula | C18H14N2O |
|---|---|
| Molecular weight | 274.3 g/mol |
| IUPAC name | (4S)-4-phenyl-2-quinolin-2-yl-4,5-dihydro-1,3-oxazole |
| InChIKey | OIFADUQNTPUCKK-QGZVFWFLSA-N |
| SMILES | C1[C@@H](N=C(O1)C2=NC3=CC=CC=C3C=C2)C4=CC=CC=C4 |
Computed by PubChem (NCBI)