CAS 80109-63-3 appears in our catalog under these names: Desoxyquinocetone, >95% (HPLC), Desoxyquinocetone, Bisdesoxyquinoceton, Bisdesoxyquinoceton, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: TRC, Biosynth, HPC Standards. Available pack sizes: 100mg, 1g, 1000mg, 1x5mg, 1x1ml.
(E)-1-(3-methylquinoxalin-2-yl)-3-phenylprop-2-en-1-one (CAS 80109-63-3) is a chemical compound with the molecular formula C18H14N2O and a molecular weight of 274.3 g/mol. IUPAC name: (E)-1-(3-methylquinoxalin-2-yl)-3-phenylprop-2-en-1-one. InChIKey: MWUVOSGDEVWDFA-VAWYXSNFSA-N.
| Molecular formula | C18H14N2O |
|---|---|
| Molecular weight | 274.3 g/mol |
| IUPAC name | (E)-1-(3-methylquinoxalin-2-yl)-3-phenylprop-2-en-1-one |
| InChIKey | MWUVOSGDEVWDFA-VAWYXSNFSA-N |
| SMILES | CC1=NC2=CC=CC=C2N=C1C(=O)/C=C/C3=CC=CC=C3 |
Computed by PubChem (NCBI)