Products 2007919-60-8
CAS 2007919-60-8 is the registry number for 2-Benzoyl-8-methyl-2,3-dihydroisoquinoline-1-carbonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-benzoyl-8-methyl-3H-isoquinoline-1-carbonitrile (CAS 2007919-60-8) is a chemical compound with the molecular formula C18H14N2O and a molecular weight of 274.3 g/mol. IUPAC name: 2-benzoyl-8-methyl-3H-isoquinoline-1-carbonitrile. InChIKey: PDTWTQDRQWPYGI-UHFFFAOYSA-N.
| Molecular formula | C18H14N2O |
|---|---|
| Molecular weight | 274.3 g/mol |
| IUPAC name | 2-benzoyl-8-methyl-3H-isoquinoline-1-carbonitrile |
| InChIKey | PDTWTQDRQWPYGI-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC2=CCN(C(=C12)C#N)C(=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)