CAS 1252784-93-2 is the registry number for (S)-N-Cyclopropylmethyl Oripavine Bromide. Offered by: TRC. Available pack sizes: 10mg, 25mg, 50mg.
Ethyl 2-[4-chloro-2-(trideuteriomethyl)phenoxy]acetate (CAS 1252784-93-2) is a chemical compound with the molecular formula C11H13ClO3 and a molecular weight of 231.69 g/mol. IUPAC name: ethyl 2-[4-chloro-2-(trideuteriomethyl)phenoxy]acetate. InChIKey: OUYDEKFRLSFDMU-BMSJAHLVSA-N.
| Molecular formula | C11H13ClO3 |
|---|---|
| Molecular weight | 231.69 g/mol |
| IUPAC name | ethyl 2-[4-chloro-2-(trideuteriomethyl)phenoxy]acetate |
| InChIKey | OUYDEKFRLSFDMU-BMSJAHLVSA-N |
| SMILES | [2H]C([2H])([2H])C1=C(C=CC(=C1)Cl)OCC(=O)OCC |
Computed by PubChem (NCBI)