CAS 1252927-45-9 appears in our catalog under these names: Pazopanib Impurity 11, N-(4-Chloro-2-pyrimidinyl)-N,2,3-trimethyl-2H-indazol-6-amine. Offered by: Hubei YoungXin, TRC, Biosynth. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 5mg.
N-(4-chloropyrimidin-2-yl)-N,2,3-trimethylindazol-6-amine (CAS 1252927-45-9) is a chemical compound with the molecular formula C14H14ClN5 and a molecular weight of 287.75 g/mol. IUPAC name: N-(4-chloropyrimidin-2-yl)-N,2,3-trimethylindazol-6-amine. InChIKey: JYPPKOMRVIEEAF-UHFFFAOYSA-N.
| Molecular formula | C14H14ClN5 |
|---|---|
| Molecular weight | 287.75 g/mol |
| IUPAC name | N-(4-chloropyrimidin-2-yl)-N,2,3-trimethylindazol-6-amine |
| InChIKey | JYPPKOMRVIEEAF-UHFFFAOYSA-N |
| SMILES | CC1=C2C=CC(=CC2=NN1C)N(C)C3=NC=CC(=N3)Cl |
Computed by PubChem (NCBI)