CAS 393784-05-9 is the registry number for 1-(4-Chlorophenyl)-N-isopropyl-1H-pyrazolo[3,4-d]pyrimidin-4-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(4-chlorophenyl)-N-propan-2-ylpyrazolo[3,4-d]pyrimidin-4-amine (CAS 393784-05-9) is a chemical compound with the molecular formula C14H14ClN5 and a molecular weight of 287.75 g/mol. IUPAC name: 1-(4-chlorophenyl)-N-propan-2-ylpyrazolo[3,4-d]pyrimidin-4-amine. InChIKey: DJYPPKXJBSHHDF-UHFFFAOYSA-N.
| Molecular formula | C14H14ClN5 |
|---|---|
| Molecular weight | 287.75 g/mol |
| IUPAC name | 1-(4-chlorophenyl)-N-propan-2-ylpyrazolo[3,4-d]pyrimidin-4-amine |
| InChIKey | DJYPPKXJBSHHDF-UHFFFAOYSA-N |
| SMILES | CC(C)NC1=C2C=NN(C2=NC=N1)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)