Products 134867-97-3
CAS 134867-97-3 is the registry number for G256. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[(Z)-[(2-amino-5-chlorophenyl)-phenylmethylidene]amino]guanidine (CAS 134867-97-3) is a chemical compound with the molecular formula C14H14ClN5 and a molecular weight of 287.75 g/mol. IUPAC name: 2-[(Z)-[(2-amino-5-chlorophenyl)-phenylmethylidene]amino]guanidine. InChIKey: VOMKMECTFJLAPY-UYRXBGFRSA-N.
| Molecular formula | C14H14ClN5 |
|---|---|
| Molecular weight | 287.75 g/mol |
| IUPAC name | 2-[(Z)-[(2-amino-5-chlorophenyl)-phenylmethylidene]amino]guanidine |
| InChIKey | VOMKMECTFJLAPY-UYRXBGFRSA-N |
| SMILES | C1=CC=C(C=C1)/C(=N/N=C(N)N)/C2=C(C=CC(=C2)Cl)N |
Computed by PubChem (NCBI)