CAS 125299-89-0 is the registry number for 3-(R)-3-Hydroxyprazepam. Offered by: TRC. Available pack sizes: 50mg.
(3R)-7-chloro-1-(cyclopropylmethyl)-3-hydroxy-5-phenyl-3H-1,4-benzodiazepin-2-one (CAS 125299-89-0) is a chemical compound with the molecular formula C19H17ClN2O2 and a molecular weight of 340.8 g/mol. IUPAC name: (3R)-7-chloro-1-(cyclopropylmethyl)-3-hydroxy-5-phenyl-3H-1,4-benzodiazepin-2-one. InChIKey: SYUMLTUHTWFDGE-GOSISDBHSA-N.
| Molecular formula | C19H17ClN2O2 |
|---|---|
| Molecular weight | 340.8 g/mol |
| IUPAC name | (3R)-7-chloro-1-(cyclopropylmethyl)-3-hydroxy-5-phenyl-3H-1,4-benzodiazepin-2-one |
| InChIKey | SYUMLTUHTWFDGE-GOSISDBHSA-N |
| SMILES | C1CC1CN2C3=C(C=C(C=C3)Cl)C(=N[C@@H](C2=O)O)C4=CC=CC=C4 |
Computed by PubChem (NCBI)