CAS 82789-40-0 is the registry number for Methyl 1-(4-chlorophenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 1-(4-chlorophenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylate (CAS 82789-40-0) is a chemical compound with the molecular formula C19H17ClN2O2 and a molecular weight of 340.8 g/mol. IUPAC name: methyl 1-(4-chlorophenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylate. InChIKey: XGVZWMNWLZHJDM-UHFFFAOYSA-N.
| Molecular formula | C19H17ClN2O2 |
|---|---|
| Molecular weight | 340.8 g/mol |
| IUPAC name | methyl 1-(4-chlorophenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylate |
| InChIKey | XGVZWMNWLZHJDM-UHFFFAOYSA-N |
| SMILES | COC(=O)C1CC2=C(C(N1)C3=CC=C(C=C3)Cl)NC4=CC=CC=C24 |
Computed by PubChem (NCBI)