CAS 18818-61-6 appears in our catalog under these names: 3-Hydroxy Prazepam, 3-Hydroxy Prazepam (1mg/ml in Acetonitrile). Offered by: TRC. Available pack sizes: 10mg, 1mg, 1x1ml.
7-chloro-1-(cyclopropylmethyl)-3-hydroxy-5-phenyl-3H-1,4-benzodiazepin-2-one (CAS 18818-61-6) is a chemical compound with the molecular formula C19H17ClN2O2 and a molecular weight of 340.8 g/mol. IUPAC name: 7-chloro-1-(cyclopropylmethyl)-3-hydroxy-5-phenyl-3H-1,4-benzodiazepin-2-one. InChIKey: SYUMLTUHTWFDGE-UHFFFAOYSA-N.
| Molecular formula | C19H17ClN2O2 |
|---|---|
| Molecular weight | 340.8 g/mol |
| IUPAC name | 7-chloro-1-(cyclopropylmethyl)-3-hydroxy-5-phenyl-3H-1,4-benzodiazepin-2-one |
| InChIKey | SYUMLTUHTWFDGE-UHFFFAOYSA-N |
| SMILES | C1CC1CN2C3=C(C=C(C=C3)Cl)C(=NC(C2=O)O)C4=CC=CC=C4 |
Computed by PubChem (NCBI)