Products 1253056-12-0
CAS 1253056-12-0 appears in our catalog under these names: Sitagliptin Impurity 61, (S)-Methyl 3-amino-4-(2,4,5-trifluorophenyl)butanoate hydrochloride, 95%, (S)-Methyl 3-amino-4-(2,4,5-trifluorophenyl)butanoate hydrochloride, (S)-Methyl 3-amino-4-(2,4,5-trifluorophe, nyl)butanoate hydrochloride, 25 mg, (S)-Methyl 3-amino-4-(2,4,5-trifluorophe, nyl)butanoate hydrochloride, 50 mg. Offered by: Chemat Brand, AmBeed, Biosynth, Roth. Available pack sizes: on request, 250mg, 1g, 25mg, 50mg, 100mg, 500mg.
Methyl (3S)-3-amino-4-(2,4,5-trifluorophenyl)butanoate;hydrochloride (CAS 1253056-12-0) is a chemical compound with the molecular formula C11H13ClF3NO2 and a molecular weight of 283.67 g/mol. IUPAC name: methyl (3S)-3-amino-4-(2,4,5-trifluorophenyl)butanoate;hydrochloride. InChIKey: HZHUQANPVYGJKF-FJXQXJEOSA-N.
| Molecular formula | C11H13ClF3NO2 |
|---|---|
| Molecular weight | 283.67 g/mol |
| IUPAC name | methyl (3S)-3-amino-4-(2,4,5-trifluorophenyl)butanoate;hydrochloride |
| InChIKey | HZHUQANPVYGJKF-FJXQXJEOSA-N |
| SMILES | COC(=O)C[C@H](CC1=CC(=C(C=C1F)F)F)N.Cl |
Computed by PubChem (NCBI)