CAS 332061-83-3 is the registry number for (R)-3-Amino-4-(4-trifluoromethylphenyl)butanoic acid hydrochloride, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg, 100mg.
(3R)-3-amino-4-[4-(trifluoromethyl)phenyl]butanoic acid;hydrochloride (CAS 332061-83-3) is a chemical compound with the molecular formula C11H13ClF3NO2 and a molecular weight of 283.67 g/mol. IUPAC name: (3R)-3-amino-4-[4-(trifluoromethyl)phenyl]butanoic acid;hydrochloride. InChIKey: AAAGEGKCWDZYHR-SBSPUUFOSA-N.
| Molecular formula | C11H13ClF3NO2 |
|---|---|
| Molecular weight | 283.67 g/mol |
| IUPAC name | (3R)-3-amino-4-[4-(trifluoromethyl)phenyl]butanoic acid;hydrochloride |
| InChIKey | AAAGEGKCWDZYHR-SBSPUUFOSA-N |
| SMILES | C1=CC(=CC=C1C[C@H](CC(=O)O)N)C(F)(F)F.Cl |
Computed by PubChem (NCBI)