CAS 269726-73-0 appears in our catalog under these names: (R)-3-Amino-4-(3-trifluoromethylphenyl)butanoic acid hydrochloride, 95%, H-D-β-HoPhe(3-CF3)-OH, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg.
(3R)-3-amino-4-[3-(trifluoromethyl)phenyl]butanoic acid;hydrochloride (CAS 269726-73-0) is a chemical compound with the molecular formula C11H13ClF3NO2 and a molecular weight of 283.67 g/mol. IUPAC name: (3R)-3-amino-4-[3-(trifluoromethyl)phenyl]butanoic acid;hydrochloride. InChIKey: NFVRYVAWNUBDCU-SBSPUUFOSA-N.
| Molecular formula | C11H13ClF3NO2 |
|---|---|
| Molecular weight | 283.67 g/mol |
| IUPAC name | (3R)-3-amino-4-[3-(trifluoromethyl)phenyl]butanoic acid;hydrochloride |
| InChIKey | NFVRYVAWNUBDCU-SBSPUUFOSA-N |
| SMILES | C1=CC(=CC(=C1)C(F)(F)F)C[C@H](CC(=O)O)N.Cl |
Computed by PubChem (NCBI)