Products 1253107-42-4
CAS 1253107-42-4 appears in our catalog under these names: 9-Anthraceneacetic acid 2,5-dioxo-1-pyrrolidinyl ester, 98%, 9-Anthraceneacetic Acid 2,5-Dioxo-1-pyrrolidinyl Ester. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 10mg, 25mg, 5mg.
(2,5-dioxopyrrolidin-1-yl) 2-anthracen-9-ylacetate (CAS 1253107-42-4) is a chemical compound with the molecular formula C20H15NO4 and a molecular weight of 333.3 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 2-anthracen-9-ylacetate. InChIKey: LOHPSCVBJVUCMN-UHFFFAOYSA-N.
| Molecular formula | C20H15NO4 |
|---|---|
| Molecular weight | 333.3 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 2-anthracen-9-ylacetate |
| InChIKey | LOHPSCVBJVUCMN-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)CC2=C3C=CC=CC3=CC4=CC=CC=C42 |
Computed by PubChem (NCBI)