CAS 181188-86-3 appears in our catalog under these names: 4,4'-(Phenylazanediyl)dibenzoic acid, 95%, 4,4′-(Phenylimino)bis[benzoic acid], 95%, 95%, 4,4'-(Phenylazanediyl)dibenzoic acid, 98%. Offered by: Chemat Brand, Chemat, Fluorochem. Available pack sizes: on request, 100mg, 250mg, 1g.
4-(N-(4-carboxyphenyl)anilino)benzoic acid (CAS 181188-86-3) is a chemical compound with the molecular formula C20H15NO4 and a molecular weight of 333.3 g/mol. IUPAC name: 4-(N-(4-carboxyphenyl)anilino)benzoic acid. InChIKey: CTTCNCPHKDSWGJ-UHFFFAOYSA-N.
| Molecular formula | C20H15NO4 |
|---|---|
| Molecular weight | 333.3 g/mol |
| IUPAC name | 4-(N-(4-carboxyphenyl)anilino)benzoic acid |
| InChIKey | CTTCNCPHKDSWGJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N(C2=CC=C(C=C2)C(=O)O)C3=CC=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)