CAS 186891-10-1 appears in our catalog under these names: 2-(4-Phenoxybenzamido)benzoic acid, 95%, 2-(4-Phenoxybenzamido)benzoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
2-[(4-phenoxybenzoyl)amino]benzoic acid (CAS 186891-10-1) is a chemical compound with the molecular formula C20H15NO4 and a molecular weight of 333.3 g/mol. IUPAC name: 2-[(4-phenoxybenzoyl)amino]benzoic acid. InChIKey: JGJOCGGZCJCKRX-UHFFFAOYSA-N.
| Molecular formula | C20H15NO4 |
|---|---|
| Molecular weight | 333.3 g/mol |
| IUPAC name | 2-[(4-phenoxybenzoyl)amino]benzoic acid |
| InChIKey | JGJOCGGZCJCKRX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC=C(C=C2)C(=O)NC3=CC=CC=C3C(=O)O |
Computed by PubChem (NCBI)