CAS 125328-76-9 appears in our catalog under these names: 5-Bromo-4-chloro-3-indoxyl-1-acetate, 95%, 5-Bromo-4-chloro-3-indoxyl-1-acetate. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 250mg, 100mg, 500mg, 1000mg, 2000mg.
1-(5-bromo-4-chloro-3-hydroxyindol-1-yl)ethanone (CAS 125328-76-9) is a chemical compound with the molecular formula C10H7BrClNO2 and a molecular weight of 288.52 g/mol. IUPAC name: 1-(5-bromo-4-chloro-3-hydroxyindol-1-yl)ethanone. InChIKey: DQYKDYVAYNNRER-UHFFFAOYSA-N.
| Molecular formula | C10H7BrClNO2 |
|---|---|
| Molecular weight | 288.52 g/mol |
| IUPAC name | 1-(5-bromo-4-chloro-3-hydroxyindol-1-yl)ethanone |
| InChIKey | DQYKDYVAYNNRER-UHFFFAOYSA-N |
| SMILES | CC(=O)N1C=C(C2=C1C=CC(=C2Cl)Br)O |
Computed by PubChem (NCBI)