CAS 557093-35-3 is the registry number for 2H-Indol-2-one, 6-bromo-5-(2-chloroacetyl)-1,3-dihydro-, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
6-bromo-5-(2-chloroacetyl)-1,3-dihydroindol-2-one (CAS 557093-35-3) is a chemical compound with the molecular formula C10H7BrClNO2 and a molecular weight of 288.52 g/mol. IUPAC name: 6-bromo-5-(2-chloroacetyl)-1,3-dihydroindol-2-one. InChIKey: LXZYAAIBJHATNU-UHFFFAOYSA-N.
| Molecular formula | C10H7BrClNO2 |
|---|---|
| Molecular weight | 288.52 g/mol |
| IUPAC name | 6-bromo-5-(2-chloroacetyl)-1,3-dihydroindol-2-one |
| InChIKey | LXZYAAIBJHATNU-UHFFFAOYSA-N |
| SMILES | C1C2=CC(=C(C=C2NC1=O)Br)C(=O)CCl |
Computed by PubChem (NCBI)